C20H25F3N4O6 — CID 151324980
3-[[1-[2-[[4-amino-3-(trifluoromethyl)benzoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-hydroxybutanoic acid (PubChem CID 151324980) has the molecular formula C20H25F3N4O6 and a molecular weight of 474.44 g/mol. Its IUPAC name is 3-[[1-[2-[[4-amino-3-(trifluoromethyl)benzoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 3-[[1-[2-[[4-amino-3-(trifluoromethyl)benzoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 151324980 |
| Molecular Formula | C20H25F3N4O6 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-[[1-[2-[[4-amino-3-(trifluoromethyl)benzoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-4-hydroxybutanoic acid |
| SMILES | CC(NC(=O)c1ccc(N)c(C(F)(F)F)c1)C(=O)N1CCCC1C(=O)NC(CO)CC(=O)O |
| InChI | InChI=1S/C20H25F3N4O6/c1-10(25-17(31)11-4-5-14(24)13(7-11)20(21,22)23)19(33)27-6-2-3-15(27)18(32)26-12(9-28)8-16(29)30/h4-5,7,10,12,15,28H,2-3,6,8-9,24H2,1H3,(H,25,31)(H,26,32)(H,29,30) |
| InChIKey | OHFXNATZECTMNI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|