C23H32ClN3O5 — CID 147083287
3-[[1-[2-[2-(4-amino-3-chlorophenyl)-2-oxoethyl]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]butanoic acid (PubChem CID 147083287) has the molecular formula C23H32ClN3O5 and a molecular weight of 465.98 g/mol. Its IUPAC name is 3-[[1-[2-[2-(4-amino-3-chlorophenyl)-2-oxoethyl]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]butanoic acid.
| Compound Name | 3-[[1-[2-[2-(4-amino-3-chlorophenyl)-2-oxoethyl]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 147083287 |
| Molecular Formula | C23H32ClN3O5 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 3-[[1-[2-[2-(4-amino-3-chlorophenyl)-2-oxoethyl]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)C1CCCN1C(=O)C(CC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C23H32ClN3O5/c1-13(10-20(29)30)26-21(31)18-6-5-9-27(18)22(32)15(23(2,3)4)12-19(28)14-7-8-17(25)16(24)11-14/h7-8,11,13,15,18H,5-6,9-10,12,25H2,1-4H3,(H,26,31)(H,29,30) |
| InChIKey | BHIQQYMDEXIVAD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|