C26H34Cl2N4O7 — CID 71470445
(Z,3S)-3-[[(2R)-1-[(2R)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-5-chloro-6-ethoxy-6-oxohex-4-enoic acid (PubChem CID 71470445) has the molecular formula C26H34Cl2N4O7 and a molecular weight of 585.49 g/mol. Its IUPAC name is (Z,3S)-3-[[(2R)-1-[(2R)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-5-chloro-6-ethoxy-6-oxohex-4-enoic acid.
| Compound Name | (Z,3S)-3-[[(2R)-1-[(2R)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-5-chloro-6-ethoxy-6-oxohex-4-enoic acid |
|---|---|
| PubChem CID | 71470445 |
| Molecular Formula | C26H34Cl2N4O7 |
| Molecular Weight | 585.49 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | (Z,3S)-3-[[(2R)-1-[(2R)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-5-chloro-6-ethoxy-6-oxohex-4-enoic acid |
| SMILES | CCOC(=O)/C(Cl)=C/[C@H](CC(=O)O)NC(=O)[C@H]1CCCN1C(=O)[C@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C26H34Cl2N4O7/c1-5-39-25(38)17(28)12-15(13-20(33)34)30-23(36)19-7-6-10-32(19)24(37)21(26(2,3)4)31-22(35)14-8-9-18(29)16(27)11-14/h8-9,11-12,15,19,21H,5-7,10,13,29H2,1-4H3,(H,30,36)(H,31,35)(H,33,34)/b17-12-/t15-,19-,21+/m1/s1 |
| InChIKey | TXKOTWVFWKOZTI-KQDUIUSWSA-N |
| XLogP | 2.70 |
| TPSA | 168.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|