C23H31N3O7 — CID 59043828
(3S)-3-[[1-[(2S)-2-[(4-methoxybenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 59043828) has the molecular formula C23H31N3O7 and a molecular weight of 461.52 g/mol. Its IUPAC name is (3S)-3-[[1-[(2S)-2-[(4-methoxybenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[1-[(2S)-2-[(4-methoxybenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59043828 |
| Molecular Formula | C23H31N3O7 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (3S)-3-[[1-[(2S)-2-[(4-methoxybenzoyl)amino]-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | COc1ccc(C(=O)N[C@H](C(=O)N2CCCC2C(=O)N[C@H](C=O)CC(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H31N3O7/c1-23(2,3)19(25-20(30)14-7-9-16(33-4)10-8-14)22(32)26-11-5-6-17(26)21(31)24-15(13-27)12-18(28)29/h7-10,13,15,17,19H,5-6,11-12H2,1-4H3,(H,24,31)(H,25,30)(H,28,29)/t15-,17?,19+/m0/s1 |
| InChIKey | VPYSGJZNSWDZIW-APROBQCTSA-N |
| XLogP | 0.99 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|