C26H29ClN4O6 — CID 59043793
1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 59043793) has the molecular formula C26H29ClN4O6 and a molecular weight of 528.99 g/mol. Its IUPAC name is 1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59043793 |
| Molecular Formula | C26H29ClN4O6 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 1-[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]propanoyl]-N-[(3S)-5-oxo-2-phenylmethoxyoxolan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccc(N)c(Cl)c1)C(=O)N1CCCC1C(=O)N[C@H]1CC(=O)OC1OCc1ccccc1 |
| InChI | InChI=1S/C26H29ClN4O6/c1-15(29-23(33)17-9-10-19(28)18(27)12-17)25(35)31-11-5-8-21(31)24(34)30-20-13-22(32)37-26(20)36-14-16-6-3-2-4-7-16/h2-4,6-7,9-10,12,15,20-21,26H,5,8,11,13-14,28H2,1H3,(H,29,33)(H,30,34)/t15-,20-,21?,26?/m0/s1 |
| InChIKey | ITGPWEMXJOZHNE-KLJWWBQPSA-N |
| XLogP | 2.01 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|