C7H15N4+ — CID 59731476
4-(2-aminoethyl)-1,2-dimethylpyrazol-2-ium-5-amine (PubChem CID 59731476) has the molecular formula C7H15N4+ and a molecular weight of 155.22 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,2-dimethylpyrazol-2-ium-5-amine.
| Compound Name | 4-(2-aminoethyl)-1,2-dimethylpyrazol-2-ium-5-amine |
|---|---|
| PubChem CID | 59731476 |
| Molecular Formula | C7H15N4+ |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 4-(2-aminoethyl)-1,2-dimethylpyrazol-2-ium-5-amine |
| SMILES | Cn1c(N)c(CCN)c[n+]1C |
| InChI | InChI=1S/C7H14N4/c1-10-5-6(3-4-8)7(9)11(10)2/h5,9H,3-4,8H2,1-2H3/p+1 |
| InChIKey | DNBBVPOELCXESW-UHFFFAOYSA-O |
| XLogP | -1.07 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|