C20H18N4O3S — CID 59732315
benzyl N-[2-[[4-(furan-2-yl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]carbamate (PubChem CID 59732315) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is benzyl N-[2-[[4-(furan-2-yl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[[4-(furan-2-yl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 59732315 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | benzyl N-[2-[[4-(furan-2-yl)thieno[3,2-d]pyrimidin-2-yl]amino]ethyl]carbamate |
| SMILES | O=C(NCCNc1nc(-c2ccco2)c2sccc2n1)OCc1ccccc1 |
| InChI | InChI=1S/C20H18N4O3S/c25-20(27-13-14-5-2-1-3-6-14)22-10-9-21-19-23-15-8-12-28-18(15)17(24-19)16-7-4-11-26-16/h1-8,11-12H,9-10,13H2,(H,22,25)(H,21,23,24) |
| InChIKey | WDDVXDNOKPYJRK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|