C23H24N4O4S — CID 155560371
benzyl N-[2-[[6-(3,5-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]amino]ethyl]carbamate (PubChem CID 155560371) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is benzyl N-[2-[[6-(3,5-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[[6-(3,5-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 155560371 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | benzyl N-[2-[[6-(3,5-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]amino]ethyl]carbamate |
| SMILES | COc1cc(OC)cc(-c2nc3sccn3c2NCCNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N4O4S/c1-29-18-12-17(13-19(14-18)30-2)20-21(27-10-11-32-22(27)26-20)24-8-9-25-23(28)31-15-16-6-4-3-5-7-16/h3-7,10-14,24H,8-9,15H2,1-2H3,(H,25,28) |
| InChIKey | XZPWWQVJASGYFC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|