C23H31FO5S — CID 59734640
7-[(1R,2R,3R,5S)-2-[3-(6-fluoro-1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid (PubChem CID 59734640) has the molecular formula C23H31FO5S and a molecular weight of 438.56 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[3-(6-fluoro-1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[3-(6-fluoro-1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 59734640 |
| Molecular Formula | C23H31FO5S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[3-(6-fluoro-1-benzothiophen-2-yl)-3-hydroxypropyl]-3,5-dihydroxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CCC(O)c2cc3ccc(F)cc3s2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H31FO5S/c24-15-8-7-14-11-22(30-21(14)12-15)18(25)10-9-17-16(19(26)13-20(17)27)5-3-1-2-4-6-23(28)29/h7-8,11-12,16-20,25-27H,1-6,9-10,13H2,(H,28,29)/t16-,17-,18?,19+,20-/m1/s1 |
| InChIKey | SJOMUDYNXLVITH-GECPZMRISA-N |
| XLogP | 4.64 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|