C35H44F2N2O5 — CID 59734754
1-N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-[2-(4-methylphenyl)ethoxy]pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 59734754) has the molecular formula C35H44F2N2O5 and a molecular weight of 610.74 g/mol. Its IUPAC name is 1-N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-[2-(4-methylphenyl)ethoxy]pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-[2-(4-methylphenyl)ethoxy]pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 59734754 |
| Molecular Formula | C35H44F2N2O5 |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.32 |
| IUPAC Name | 1-N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-[2-(4-methylphenyl)ethoxy]pentan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)[C@H](O)COCCc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C35H44F2N2O5/c1-5-12-39(13-6-2)35(43)28-16-24(4)15-27(20-28)34(42)38-31(19-26-17-29(36)21-30(37)18-26)33(41)32(40)22-44-14-11-25-9-7-23(3)8-10-25/h7-10,15-18,20-21,31-33,40-41H,5-6,11-14,19,22H2,1-4H3,(H,38,42)/t31-,32+,33+/m0/s1 |
| InChIKey | ICTPUCMPHWUALV-WIHCDAFUSA-N |
| XLogP | 5.17 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|