C12H18BN6O3 — CID 59738174
CID 59738174 (PubChem CID 59738174) has the molecular formula C12H18BN6O3 and a molecular weight of 305.13 g/mol.
| Compound Name | CID 59738174 |
|---|---|
| PubChem CID | 59738174 |
| Molecular Formula | C12H18BN6O3 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | — |
| SMILES | NCC[B]CC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C12H18BN6O3/c14-2-1-13-3-6-8(20)9(21)12(22-6)19-5-18-7-10(15)16-4-17-11(7)19/h4-6,8-9,12,20-21H,1-3,14H2,(H2,15,16,17) |
| InChIKey | PCSOQSQWAIOJEJ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|