C21H30N2O3 — CID 59739705
(E)-1-(3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl)-4-phenylbut-2-en-1-ol (PubChem CID 59739705) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (E)-1-(3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl)-4-phenylbut-2-en-1-ol.
| Compound Name | (E)-1-(3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl)-4-phenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 59739705 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (E)-1-(3,6-diethoxy-5-propan-2-yl-2,5-dihydropyrazin-2-yl)-4-phenylbut-2-en-1-ol |
| SMILES | CCOC1=NC(C(O)/C=C/Cc2ccccc2)C(OCC)=NC1C(C)C |
| InChI | InChI=1S/C21H30N2O3/c1-5-25-20-18(15(3)4)22-21(26-6-2)19(23-20)17(24)14-10-13-16-11-8-7-9-12-16/h7-12,14-15,17-19,24H,5-6,13H2,1-4H3/b14-10+ |
| InChIKey | BWBKREHXUBPGFX-GXDHUFHOSA-N |
| XLogP | 3.42 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|