About 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene
5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene (PubChem CID 59741526) has the molecular formula C8H8
and a molecular weight of 104.15 g/mol. Its IUPAC name is 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene.
Analyze 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene?
The IUPAC name of 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene (CID 59741526) is 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene.
What is the SMILES notation for 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene?
The canonical SMILES for 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene is CC1C2=C(C2)C2=C1C2.
What is the InChIKey of 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene?
The InChIKey is VWWJPNCCALAPJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8/c1-4-5-2-7(5)8-3-6(4)8/h4H,2-3H2,1H3.
What are the key properties of 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene?
5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene has a molecular weight of 104.15 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyltricyclo[4.1.0.02,4]hepta-1(6),2(4)-diene is sourced from PubChem (CID 59741526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).