C13H17N4O2- — CID 59746322
3-[2-(dimethylamino)ethyl-methylamino]-1H-indazole-6-carboxylate (PubChem CID 59746322) has the molecular formula C13H17N4O2- and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl-methylamino]-1H-indazole-6-carboxylate.
| Compound Name | 3-[2-(dimethylamino)ethyl-methylamino]-1H-indazole-6-carboxylate |
|---|---|
| PubChem CID | 59746322 |
| Molecular Formula | C13H17N4O2- |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl-methylamino]-1H-indazole-6-carboxylate |
| SMILES | CN(C)CCN(C)c1n[nH]c2cc(C(=O)[O-])ccc12 |
| InChI | InChI=1S/C13H18N4O2/c1-16(2)6-7-17(3)12-10-5-4-9(13(18)19)8-11(10)14-15-12/h4-5,8H,6-7H2,1-3H3,(H,14,15)(H,18,19)/p-1 |
| InChIKey | LFLLVOCVBIZSAW-UHFFFAOYSA-M |
| XLogP | -0.08 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |