C29H41N3O6S — CID 59748521
acetyl 6-[[2-[4-[(E)-dec-1-enoxy]phenyl]-2-(methylamino)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 59748521) has the molecular formula C29H41N3O6S and a molecular weight of 559.73 g/mol. Its IUPAC name is acetyl 6-[[2-[4-[(E)-dec-1-enoxy]phenyl]-2-(methylamino)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | acetyl 6-[[2-[4-[(E)-dec-1-enoxy]phenyl]-2-(methylamino)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59748521 |
| Molecular Formula | C29H41N3O6S |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | acetyl 6-[[2-[4-[(E)-dec-1-enoxy]phenyl]-2-(methylamino)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CCCCCCCC/C=C/Oc1ccc(C(NC)C(=O)NC2C(=O)N3C2SC(C)(C)C3C(=O)OC(C)=O)cc1 |
| InChI | InChI=1S/C29H41N3O6S/c1-6-7-8-9-10-11-12-13-18-37-21-16-14-20(15-17-21)22(30-5)25(34)31-23-26(35)32-24(28(36)38-19(2)33)29(3,4)39-27(23)32/h13-18,22-24,27,30H,6-12H2,1-5H3,(H,31,34)/b18-13+ |
| InChIKey | YUMFQIREUDJFRP-QGOAFFKASA-N |
| XLogP | 4.23 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|