C29H46O6 — CID 59752461
8,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,9,12a-pentamethyl-2,3,4,4a,5,6,6a,6b,7,8,8a,10,11,12,13,14b-hexadecahydro-1H-picene-4-carboxylic acid (PubChem CID 59752461) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is 8,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,9,12a-pentamethyl-2,3,4,4a,5,6,6a,6b,7,8,8a,10,11,12,13,14b-hexadecahydro-1H-picene-4-carboxylic acid.
| Compound Name | 8,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,9,12a-pentamethyl-2,3,4,4a,5,6,6a,6b,7,8,8a,10,11,12,13,14b-hexadecahydro-1H-picene-4-carboxylic acid |
|---|---|
| PubChem CID | 59752461 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 8,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,9,12a-pentamethyl-2,3,4,4a,5,6,6a,6b,7,8,8a,10,11,12,13,14b-hexadecahydro-1H-picene-4-carboxylic acid |
| SMILES | CC1CC(C(=O)O)C2CCC3(C)C(=CCC4C3CC(O)C3C(C)(CO)C(O)C(O)CC43C)C2C1C |
| InChI | InChI=1S/C29H46O6/c1-14-10-17(26(34)35)16-8-9-27(3)19(23(16)15(14)2)7-6-18-20(27)11-21(31)24-28(18,4)12-22(32)25(33)29(24,5)13-30/h7,14-18,20-25,30-33H,6,8-13H2,1-5H3,(H,34,35) |
| InChIKey | GXBJBXQDTCGMPO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|