C26H23N2O2+ — CID 59755253
7,10-dimethoxy-1,12-dimethyl-3-phenylphenanthro[9,10-b]pyrazin-1-ium (PubChem CID 59755253) has the molecular formula C26H23N2O2+ and a molecular weight of 395.48 g/mol. Its IUPAC name is 7,10-dimethoxy-1,12-dimethyl-3-phenylphenanthro[9,10-b]pyrazin-1-ium.
| Compound Name | 7,10-dimethoxy-1,12-dimethyl-3-phenylphenanthro[9,10-b]pyrazin-1-ium |
|---|---|
| PubChem CID | 59755253 |
| Molecular Formula | C26H23N2O2+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 7,10-dimethoxy-1,12-dimethyl-3-phenylphenanthro[9,10-b]pyrazin-1-ium |
| SMILES | COc1ccc2c(c1)c1cc(OC)cc(C)c1c1c2nc(-c2ccccc2)c[n+]1C |
| InChI | InChI=1S/C26H23N2O2/c1-16-12-19(30-4)14-22-21-13-18(29-3)10-11-20(21)25-26(24(16)22)28(2)15-23(27-25)17-8-6-5-7-9-17/h5-15H,1-4H3/q+1 |
| InChIKey | VSPCERITWNQBHO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|