C26H23N2+ — CID 59755252
1,6,9,12-tetramethyl-3-phenylphenanthro[9,10-b]pyrazin-1-ium (PubChem CID 59755252) has the molecular formula C26H23N2+ and a molecular weight of 363.48 g/mol. Its IUPAC name is 1,6,9,12-tetramethyl-3-phenylphenanthro[9,10-b]pyrazin-1-ium.
| Compound Name | 1,6,9,12-tetramethyl-3-phenylphenanthro[9,10-b]pyrazin-1-ium |
|---|---|
| PubChem CID | 59755252 |
| Molecular Formula | C26H23N2+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1,6,9,12-tetramethyl-3-phenylphenanthro[9,10-b]pyrazin-1-ium |
| SMILES | Cc1ccc2c(c1)c1nc(-c3ccccc3)c[n+](C)c1c1c(C)ccc(C)c21 |
| InChI | InChI=1S/C26H23N2/c1-16-10-13-20-21(14-16)25-26(24-18(3)12-11-17(2)23(20)24)28(4)15-22(27-25)19-8-6-5-7-9-19/h5-15H,1-4H3/q+1 |
| InChIKey | LODBUIQIWQIXAN-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|