C23H25ClF3N3O5 — CID 59756419
(3R)-1-[2-chloro-4-(2,2,2-trifluoroethoxy)benzoyl]-N-(1,3-dihydroxypropan-2-yl)-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide (PubChem CID 59756419) has the molecular formula C23H25ClF3N3O5 and a molecular weight of 515.92 g/mol. Its IUPAC name is (3R)-1-[2-chloro-4-(2,2,2-trifluoroethoxy)benzoyl]-N-(1,3-dihydroxypropan-2-yl)-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide.
| Compound Name | (3R)-1-[2-chloro-4-(2,2,2-trifluoroethoxy)benzoyl]-N-(1,3-dihydroxypropan-2-yl)-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
|---|---|
| PubChem CID | 59756419 |
| Molecular Formula | C23H25ClF3N3O5 |
| Molecular Weight | 515.92 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | (3R)-1-[2-chloro-4-(2,2,2-trifluoroethoxy)benzoyl]-N-(1,3-dihydroxypropan-2-yl)-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(OCC(F)(F)F)cc2Cl)c2ccccc2CN1C(=O)NC(CO)CO |
| InChI | InChI=1S/C23H25ClF3N3O5/c1-14-9-30(21(33)18-7-6-17(8-19(18)24)35-13-23(25,26)27)20-5-3-2-4-15(20)10-29(14)22(34)28-16(11-31)12-32/h2-8,14,16,31-32H,9-13H2,1H3,(H,28,34)/t14-/m1/s1 |
| InChIKey | JMCYTUDMSXVLSO-CQSZACIVSA-N |
| XLogP | 3.19 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.92 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |