C11H7Cl3N2OS — CID 597575
1-(4-chlorophenyl)-3-(2,5-dichlorothiophen-3-yl)urea (PubChem CID 597575) has the molecular formula C11H7Cl3N2OS and a molecular weight of 321.62 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2,5-dichlorothiophen-3-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(2,5-dichlorothiophen-3-yl)urea |
|---|---|
| PubChem CID | 597575 |
| Molecular Formula | C11H7Cl3N2OS |
| Molecular Weight | 321.62 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2,5-dichlorothiophen-3-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H7Cl3N2OS/c12-6-1-3-7(4-2-6)15-11(17)16-8-5-9(13)18-10(8)14/h1-5H,(H2,15,16,17) |
| InChIKey | ATSYDUMDYSZPLK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |