C14H14Cl2N2O3S2 — CID 2819678
1-(4-chlorophenyl)-3-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)urea (PubChem CID 2819678) has the molecular formula C14H14Cl2N2O3S2 and a molecular weight of 393.32 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)urea |
|---|---|
| PubChem CID | 2819678 |
| Molecular Formula | C14H14Cl2N2O3S2 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3-chloro-4-propan-2-ylsulfonylthiophen-2-yl)urea |
| SMILES | CC(C)S(=O)(=O)c1csc(NC(=O)Nc2ccc(Cl)cc2)c1Cl |
| InChI | InChI=1S/C14H14Cl2N2O3S2/c1-8(2)23(20,21)11-7-22-13(12(11)16)18-14(19)17-10-5-3-9(15)4-6-10/h3-8H,1-2H3,(H2,17,18,19) |
| InChIKey | OUGHAXAUJATQGA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |