C37H27F6IrN6P+ — CID 59757589
diphenyl(phenylmethyl)phosphanium;iridium(3+);bis(2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine) (PubChem CID 59757589) has the molecular formula C37H27F6IrN6P+ and a molecular weight of 892.84 g/mol. Its IUPAC name is diphenyl(phenylmethyl)phosphanium;iridium(3+);bis(2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine).
| Compound Name | diphenyl(phenylmethyl)phosphanium;iridium(3+);bis(2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine) |
|---|---|
| PubChem CID | 59757589 |
| Molecular Formula | C37H27F6IrN6P+ |
| Molecular Weight | 892.84 g/mol |
| Exact Mass | 893.16 |
| IUPAC Name | diphenyl(phenylmethyl)phosphanium;iridium(3+);bis(2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine) |
| SMILES | FC(F)(F)c1cc(-c2ccccn2)[n-]n1.FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[Ir+3].[c-]1ccccc1C[PH+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16P.2C9H5F3N3.Ir/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;2*10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;/h1-10,12-15H,16H2;2*1-5H;/q3*-1;+3/p+1 |
| InChIKey | ONIGWFQRKQMHCR-UHFFFAOYSA-O |
| XLogP | 8.09 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.84 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|