C21H19FN2O5S2 — CID 59759209
2-[[4-[2-[4-(4-fluorophenyl)-2-nitrophenoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoic acid (PubChem CID 59759209) has the molecular formula C21H19FN2O5S2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 2-[[4-[2-[4-(4-fluorophenyl)-2-nitrophenoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[[4-[2-[4-(4-fluorophenyl)-2-nitrophenoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59759209 |
| Molecular Formula | C21H19FN2O5S2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-[[4-[2-[4-(4-fluorophenyl)-2-nitrophenoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoic acid |
| SMILES | CC(C)(Sc1nc(CCOc2ccc(-c3ccc(F)cc3)cc2[N+](=O)[O-])cs1)C(=O)O |
| InChI | InChI=1S/C21H19FN2O5S2/c1-21(2,19(25)26)31-20-23-16(12-30-20)9-10-29-18-8-5-14(11-17(18)24(27)28)13-3-6-15(22)7-4-13/h3-8,11-12H,9-10H2,1-2H3,(H,25,26) |
| InChIKey | AKPUAWPWWBTZMY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|