C24H26FNO3S2 — CID 59759324
ethyl 2-[[4-[2-[[4-(4-fluorophenyl)phenyl]methoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate (PubChem CID 59759324) has the molecular formula C24H26FNO3S2 and a molecular weight of 459.61 g/mol. Its IUPAC name is ethyl 2-[[4-[2-[[4-(4-fluorophenyl)phenyl]methoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate.
| Compound Name | ethyl 2-[[4-[2-[[4-(4-fluorophenyl)phenyl]methoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 59759324 |
| Molecular Formula | C24H26FNO3S2 |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | ethyl 2-[[4-[2-[[4-(4-fluorophenyl)phenyl]methoxy]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Sc1nc(CCOCc2ccc(-c3ccc(F)cc3)cc2)cs1 |
| InChI | InChI=1S/C24H26FNO3S2/c1-4-29-22(27)24(2,3)31-23-26-21(16-30-23)13-14-28-15-17-5-7-18(8-6-17)19-9-11-20(25)12-10-19/h5-12,16H,4,13-15H2,1-3H3 |
| InChIKey | VMRPPPLBHXEZKT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|