About 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol
2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol (PubChem CID 59760904) has the molecular formula C9H18O6
and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol.
Analyze 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol?
The IUPAC name of 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol (CID 59760904) is 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol.
What is the SMILES notation for 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol?
The canonical SMILES for 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol is OCCCC1OC(CO)C(O)C(O)C1O.
What is the InChIKey of 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol?
The InChIKey is OEJBBTFZQJKJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O6/c10-3-1-2-5-7(12)9(14)8(13)6(4-11)15-5/h5-14H,1-4H2.
What are the key properties of 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol?
2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol has a molecular weight of 222.24 g/mol, XLogP of -2.40, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-6-(3-hydroxypropyl)oxane-3,4,5-triol is sourced from PubChem (CID 59760904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).