C21H25Cl2N5 — CID 59761359
N'-[(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine (PubChem CID 59761359) has the molecular formula C21H25Cl2N5 and a molecular weight of 418.37 g/mol. Its IUPAC name is N'-[(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine.
| Compound Name | N'-[(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 59761359 |
| Molecular Formula | C21H25Cl2N5 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N'-[(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)methyl]-N'-(5,6,7,8-tetrahydroquinolin-8-yl)butane-1,4-diamine |
| SMILES | NCCCCN(Cc1cn2cc(Cl)cc(Cl)c2n1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C21H25Cl2N5/c22-16-11-18(23)21-26-17(14-28(21)12-16)13-27(10-2-1-8-24)19-7-3-5-15-6-4-9-25-20(15)19/h4,6,9,11-12,14,19H,1-3,5,7-8,10,13,24H2 |
| InChIKey | QATMNIAUJJCKKZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|