C27H32N6O — CID 121284940
2-[3-[[4-aminobutyl-[(8R)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]acetamide (PubChem CID 121284940) has the molecular formula C27H32N6O and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[3-[[4-aminobutyl-[(8R)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]acetamide.
| Compound Name | 2-[3-[[4-aminobutyl-[(8R)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]acetamide |
|---|---|
| PubChem CID | 121284940 |
| Molecular Formula | C27H32N6O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-[3-[[4-aminobutyl-[(8R)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]acetamide |
| SMILES | NCCCCN(Cc1cc2c3ccccc3n(CC(N)=O)c2cn1)[C@@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C27H32N6O/c28-12-3-4-14-32(24-11-5-7-19-8-6-13-30-27(19)24)17-20-15-22-21-9-1-2-10-23(21)33(18-26(29)34)25(22)16-31-20/h1-2,6,8-10,13,15-16,24H,3-5,7,11-12,14,17-18,28H2,(H2,29,34)/t24-/m1/s1 |
| InChIKey | CKGSHMLSFHGVTE-XMMPIXPASA-N |
| XLogP | 3.69 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|