C27H31N5O2 — CID 72535441
2-[1-[[4-aminobutyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrido[3,4-b]indol-9-yl]acetic acid (PubChem CID 72535441) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 2-[1-[[4-aminobutyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrido[3,4-b]indol-9-yl]acetic acid.
| Compound Name | 2-[1-[[4-aminobutyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrido[3,4-b]indol-9-yl]acetic acid |
|---|---|
| PubChem CID | 72535441 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 2-[1-[[4-aminobutyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrido[3,4-b]indol-9-yl]acetic acid |
| SMILES | NCCCCN(Cc1nccc2c3ccccc3n(CC(=O)O)c12)C1CCCc2cccnc21 |
| InChI | InChI=1S/C27H31N5O2/c28-13-3-4-16-31(24-11-5-7-19-8-6-14-30-26(19)24)17-22-27-21(12-15-29-22)20-9-1-2-10-23(20)32(27)18-25(33)34/h1-2,6,8-10,12,14-15,24H,3-5,7,11,13,16-18,28H2,(H,33,34) |
| InChIKey | HXSKVZXRXQFNGG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|