C32H38F2N6O — CID 70964872
2-[1-[[4-aminobutyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]-1-(4,4-difluoropiperidin-1-yl)ethanone (PubChem CID 70964872) has the molecular formula C32H38F2N6O and a molecular weight of 560.69 g/mol. Its IUPAC name is 2-[1-[[4-aminobutyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]-1-(4,4-difluoropiperidin-1-yl)ethanone.
| Compound Name | 2-[1-[[4-aminobutyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]-1-(4,4-difluoropiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 70964872 |
| Molecular Formula | C32H38F2N6O |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 2-[1-[[4-aminobutyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]pyrido[3,4-b]indol-9-yl]-1-(4,4-difluoropiperidin-1-yl)ethanone |
| SMILES | NCCCCN(Cc1nccc2c3ccccc3n(CC(=O)N3CCC(F)(F)CC3)c12)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C32H38F2N6O/c33-32(34)13-19-38(20-14-32)29(41)22-40-27-10-2-1-9-24(27)25-12-17-36-26(31(25)40)21-39(18-4-3-15-35)28-11-5-7-23-8-6-16-37-30(23)28/h1-2,6,8-10,12,16-17,28H,3-5,7,11,13-15,18-22,35H2/t28-/m0/s1 |
| InChIKey | ALYSXKJIEMOVGV-NDEPHWFRSA-N |
| XLogP | 5.46 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|