C11H14N4 — CID 59763292
(4R)-6-(2-aminoethyl)-5-isocyano-2,4-dimethyl-1,4-dihydropyridine-3-carbonitrile (PubChem CID 59763292) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is (4R)-6-(2-aminoethyl)-5-isocyano-2,4-dimethyl-1,4-dihydropyridine-3-carbonitrile.
| Compound Name | (4R)-6-(2-aminoethyl)-5-isocyano-2,4-dimethyl-1,4-dihydropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59763292 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (4R)-6-(2-aminoethyl)-5-isocyano-2,4-dimethyl-1,4-dihydropyridine-3-carbonitrile |
| SMILES | [C-]#[N+]C1=C(CCN)NC(C)=C(C#N)[C@H]1C |
| InChI | InChI=1S/C11H14N4/c1-7-9(6-13)8(2)15-10(4-5-12)11(7)14-3/h7,15H,4-5,12H2,1-2H3/t7-/m1/s1 |
| InChIKey | GDSGRALPZMNMLY-SSDOTTSWSA-N |
| XLogP | 1.50 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|