C20H29N3O5 — CID 59763595
(3S)-2-N-[(2S)-1-(ethylamino)-4-methyl-1-oxopentan-2-yl]-3-N-[2-(4-hydroxyphenyl)ethyl]oxirane-2,3-dicarboxamide (PubChem CID 59763595) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is (3S)-2-N-[(2S)-1-(ethylamino)-4-methyl-1-oxopentan-2-yl]-3-N-[2-(4-hydroxyphenyl)ethyl]oxirane-2,3-dicarboxamide.
| Compound Name | (3S)-2-N-[(2S)-1-(ethylamino)-4-methyl-1-oxopentan-2-yl]-3-N-[2-(4-hydroxyphenyl)ethyl]oxirane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 59763595 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (3S)-2-N-[(2S)-1-(ethylamino)-4-methyl-1-oxopentan-2-yl]-3-N-[2-(4-hydroxyphenyl)ethyl]oxirane-2,3-dicarboxamide |
| SMILES | CCNC(=O)[C@H](CC(C)C)NC(=O)C1O[C@@H]1C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C20H29N3O5/c1-4-21-18(25)15(11-12(2)3)23-20(27)17-16(28-17)19(26)22-10-9-13-5-7-14(24)8-6-13/h5-8,12,15-17,24H,4,9-11H2,1-3H3,(H,21,25)(H,22,26)(H,23,27)/t15-,16-,17?/m0/s1 |
| InChIKey | AKWOWJYVPGEUBO-PYNWJHIZSA-N |
| XLogP | 0.49 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|