C24H35N3O6 — CID 161118992
2-N-[(4S,7S)-8-amino-7-[(4-hydroxyphenyl)methyl]-2-methyl-5,8-dioxooctan-4-yl]-3-N-(2-methylpropyl)oxirane-2,3-dicarboxamide (PubChem CID 161118992) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-N-[(4S,7S)-8-amino-7-[(4-hydroxyphenyl)methyl]-2-methyl-5,8-dioxooctan-4-yl]-3-N-(2-methylpropyl)oxirane-2,3-dicarboxamide.
| Compound Name | 2-N-[(4S,7S)-8-amino-7-[(4-hydroxyphenyl)methyl]-2-methyl-5,8-dioxooctan-4-yl]-3-N-(2-methylpropyl)oxirane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 161118992 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 2-N-[(4S,7S)-8-amino-7-[(4-hydroxyphenyl)methyl]-2-methyl-5,8-dioxooctan-4-yl]-3-N-(2-methylpropyl)oxirane-2,3-dicarboxamide |
| SMILES | CC(C)CNC(=O)C1OC1C(=O)N[C@@H](CC(C)C)C(=O)C[C@H](Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C24H35N3O6/c1-13(2)9-18(27-24(32)21-20(33-21)23(31)26-12-14(3)4)19(29)11-16(22(25)30)10-15-5-7-17(28)8-6-15/h5-8,13-14,16,18,20-21,28H,9-12H2,1-4H3,(H2,25,30)(H,26,31)(H,27,32)/t16-,18-,20?,21?/m0/s1 |
| InChIKey | AZQKUQOXCNTSDQ-GYIPLFPLSA-N |
| XLogP | 1.07 |
| TPSA | 151.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|