C28H35N3O6 — CID 158458044
2-N-[(4S,7R)-8-amino-7-[(4-hydroxyphenyl)methyl]-2-methyl-5,8-dioxooctan-4-yl]-3-N-[(1S)-1-phenylethyl]oxirane-2,3-dicarboxamide (PubChem CID 158458044) has the molecular formula C28H35N3O6 and a molecular weight of 509.60 g/mol. Its IUPAC name is 2-N-[(4S,7R)-8-amino-7-[(4-hydroxyphenyl)methyl]-2-methyl-5,8-dioxooctan-4-yl]-3-N-[(1S)-1-phenylethyl]oxirane-2,3-dicarboxamide.
| Compound Name | 2-N-[(4S,7R)-8-amino-7-[(4-hydroxyphenyl)methyl]-2-methyl-5,8-dioxooctan-4-yl]-3-N-[(1S)-1-phenylethyl]oxirane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 158458044 |
| Molecular Formula | C28H35N3O6 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 2-N-[(4S,7R)-8-amino-7-[(4-hydroxyphenyl)methyl]-2-methyl-5,8-dioxooctan-4-yl]-3-N-[(1S)-1-phenylethyl]oxirane-2,3-dicarboxamide |
| SMILES | CC(C)C[C@H](NC(=O)C1OC1C(=O)N[C@@H](C)c1ccccc1)C(=O)C[C@@H](Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C28H35N3O6/c1-16(2)13-22(23(33)15-20(26(29)34)14-18-9-11-21(32)12-10-18)31-28(36)25-24(37-25)27(35)30-17(3)19-7-5-4-6-8-19/h4-12,16-17,20,22,24-25,32H,13-15H2,1-3H3,(H2,29,34)(H,30,35)(H,31,36)/t17-,20+,22-,24?,25?/m0/s1 |
| InChIKey | VNDZKPVTFLSUJI-UXMSIQLESA-N |
| XLogP | 2.17 |
| TPSA | 151.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|