C14H12 — CID 59766474
4a,4b-dihydrophenanthrene (PubChem CID 59766474) has the molecular formula C14H12 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4a,4b-dihydrophenanthrene.
| Compound Name | 4a,4b-dihydrophenanthrene |
|---|---|
| PubChem CID | 59766474 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 4a,4b-dihydrophenanthrene |
| SMILES | C1=CC2=CC=C3C=CC=CC3C2C=C1 |
| InChI | InChI=1S/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10,13-14H |
| InChIKey | ZQNQJMXFVWUBDO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |