C10H14BN2 — CID 59766715
CID 59766715 (PubChem CID 59766715) has the molecular formula C10H14BN2 and a molecular weight of 173.05 g/mol.
| Compound Name | CID 59766715 |
|---|---|
| PubChem CID | 59766715 |
| Molecular Formula | C10H14BN2 |
| Molecular Weight | 173.05 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc(N2CC[B]CC2)nc1 |
| InChI | InChI=1S/C10H14BN2/c1-9-2-3-10(12-8-9)13-6-4-11-5-7-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | CVKPLLFPCCNKGR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.05 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|