C13H18N2O2 — CID 79026576
8-(5-methyl-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 79026576) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 8-(5-methyl-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(5-methyl-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 79026576 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 8-(5-methyl-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | Cc1ccc(N2CCC3(CC2)OCCO3)nc1 |
| InChI | InChI=1S/C13H18N2O2/c1-11-2-3-12(14-10-11)15-6-4-13(5-7-15)16-8-9-17-13/h2-3,10H,4-9H2,1H3 |
| InChIKey | DMWKELMEPXKEHC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |