C13H18N2O3 — CID 113236174
8-(5-methoxy-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 113236174) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 8-(5-methoxy-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(5-methoxy-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 113236174 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 8-(5-methoxy-2-pyridinyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | COc1ccc(N2CCC3(CC2)OCCO3)nc1 |
| InChI | InChI=1S/C13H18N2O3/c1-16-11-2-3-12(14-10-11)15-6-4-13(5-7-15)17-8-9-18-13/h2-3,10H,4-9H2,1H3 |
| InChIKey | TVRMDYCIPPDERP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |