C18H20N2O4 — CID 142581527
4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-methoxyquinoline-3-carbaldehyde (PubChem CID 142581527) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-methoxyquinoline-3-carbaldehyde.
| Compound Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-methoxyquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 142581527 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-6-methoxyquinoline-3-carbaldehyde |
| SMILES | COc1ccc2ncc(C=O)c(N3CCC4(CC3)OCCO4)c2c1 |
| InChI | InChI=1S/C18H20N2O4/c1-22-14-2-3-16-15(10-14)17(13(12-21)11-19-16)20-6-4-18(5-7-20)23-8-9-24-18/h2-3,10-12H,4-9H2,1H3 |
| InChIKey | QZFQHJLFZDIFRK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|