C22H22BrClN2O3 — CID 59766858
ethyl 2-[[(6-bromo-4-chloro-2-methoxyquinolin-3-yl)-phenylmethyl]-methylamino]acetate (PubChem CID 59766858) has the molecular formula C22H22BrClN2O3 and a molecular weight of 477.79 g/mol. Its IUPAC name is ethyl 2-[[(6-bromo-4-chloro-2-methoxyquinolin-3-yl)-phenylmethyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[(6-bromo-4-chloro-2-methoxyquinolin-3-yl)-phenylmethyl]-methylamino]acetate |
|---|---|
| PubChem CID | 59766858 |
| Molecular Formula | C22H22BrClN2O3 |
| Molecular Weight | 477.79 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | ethyl 2-[[(6-bromo-4-chloro-2-methoxyquinolin-3-yl)-phenylmethyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(c1ccccc1)c1c(OC)nc2ccc(Br)cc2c1Cl |
| InChI | InChI=1S/C22H22BrClN2O3/c1-4-29-18(27)13-26(2)21(14-8-6-5-7-9-14)19-20(24)16-12-15(23)10-11-17(16)25-22(19)28-3/h5-12,21H,4,13H2,1-3H3 |
| InChIKey | OXPSWYSYRFIRMY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |