C27H26ClN3O4 — CID 59767077
2-(1,3-benzodioxol-5-yl)-13-chloro-6-cyclohexyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 59767077) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-13-chloro-6-cyclohexyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-13-chloro-6-cyclohexyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 59767077 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-13-chloro-6-cyclohexyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1C2Cc3c([nH]c4ccc(Cl)cc34)C(c3ccc4c(c3)OCO4)N2C(=O)CN1C1CCCCC1 |
| InChI | InChI=1S/C27H26ClN3O4/c28-16-7-8-20-18(11-16)19-12-21-27(33)30(17-4-2-1-3-5-17)13-24(32)31(21)26(25(19)29-20)15-6-9-22-23(10-15)35-14-34-22/h6-11,17,21,26,29H,1-5,12-14H2 |
| InChIKey | MYBIANNWRZHTBH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|