C25H35NO8 — CID 59768021
2-[(E)-[(4S,5S,6S)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-4-[(2S)-2-methylbutanoyl]oxy-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]amino]oxyacetic acid (PubChem CID 59768021) has the molecular formula C25H35NO8 and a molecular weight of 477.55 g/mol. Its IUPAC name is 2-[(E)-[(4S,5S,6S)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-4-[(2S)-2-methylbutanoyl]oxy-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]amino]oxyacetic acid.
| Compound Name | 2-[(E)-[(4S,5S,6S)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-4-[(2S)-2-methylbutanoyl]oxy-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]amino]oxyacetic acid |
|---|---|
| PubChem CID | 59768021 |
| Molecular Formula | C25H35NO8 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 2-[(E)-[(4S,5S,6S)-5-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-6-methyl-4-[(2S)-2-methylbutanoyl]oxy-4,4a,5,6-tetrahydro-3H-naphthalen-2-ylidene]amino]oxyacetic acid |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C/C(=N\OCC(=O)O)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)C21 |
| InChI | InChI=1S/C25H35NO8/c1-4-14(2)25(31)34-21-10-17(26-32-13-22(28)29)9-16-6-5-15(3)20(24(16)21)8-7-19-11-18(27)12-23(30)33-19/h5-6,9,14-15,18-21,24,27H,4,7-8,10-13H2,1-3H3,(H,28,29)/b26-17-/t14-,15-,18+,19+,20-,21-,24?/m0/s1 |
| InChIKey | RTVAVTLQMSKLIK-GGLJLOKSSA-N |
| XLogP | 3.02 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|