C16H24BN3O2 — CID 59768352
N-[1-(tert-butylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-methylboronamidic acid (PubChem CID 59768352) has the molecular formula C16H24BN3O2 and a molecular weight of 301.20 g/mol. Its IUPAC name is N-[1-(tert-butylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-methylboronamidic acid.
| Compound Name | N-[1-(tert-butylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 59768352 |
| Molecular Formula | C16H24BN3O2 |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[1-(tert-butylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-methylboronamidic acid |
| SMILES | CB(O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H24BN3O2/c1-16(2,3)19-15(21)14(20-17(4)22)9-11-10-18-13-8-6-5-7-12(11)13/h5-8,10,14,18,20,22H,9H2,1-4H3,(H,19,21) |
| InChIKey | XTRQNRGBMRTNHB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|