C18H21ClFNO — CID 59768355
N-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 59768355) has the molecular formula C18H21ClFNO and a molecular weight of 321.82 g/mol. Its IUPAC name is N-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 59768355 |
| Molecular Formula | C18H21ClFNO |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-[[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ccc(OCc2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H21ClFNO/c1-18(2,3)21-11-14-6-9-17(16(19)10-14)22-12-13-4-7-15(20)8-5-13/h4-10,21H,11-12H2,1-3H3 |
| InChIKey | DSNHUJLKDZNVNV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |