C19H21ClF3NO — CID 59768534
N-[[3-chloro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 59768534) has the molecular formula C19H21ClF3NO and a molecular weight of 371.83 g/mol. Its IUPAC name is N-[[3-chloro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-chloro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 59768534 |
| Molecular Formula | C19H21ClF3NO |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[[3-chloro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ccc(OCc2ccc(C(F)(F)F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H21ClF3NO/c1-18(2,3)24-11-14-6-9-17(16(20)10-14)25-12-13-4-7-15(8-5-13)19(21,22)23/h4-10,24H,11-12H2,1-3H3 |
| InChIKey | SCGVMSHAZVSXQB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |