C13H8FN3O2 — CID 59769210
7-(2-fluorophenyl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one (PubChem CID 59769210) has the molecular formula C13H8FN3O2 and a molecular weight of 257.22 g/mol. Its IUPAC name is 7-(2-fluorophenyl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one.
| Compound Name | 7-(2-fluorophenyl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one |
|---|---|
| PubChem CID | 59769210 |
| Molecular Formula | C13H8FN3O2 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 7-(2-fluorophenyl)-8-hydroxy-5H-pyrido[2,3-b]pyrazin-6-one |
| SMILES | O=c1[nH]c2nccnc2c(O)c1-c1ccccc1F |
| InChI | InChI=1S/C13H8FN3O2/c14-8-4-2-1-3-7(8)9-11(18)10-12(17-13(9)19)16-6-5-15-10/h1-6H,(H2,16,17,18,19) |
| InChIKey | BJNGYSSKXPHHLE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |