C14H14N2O4 — CID 59772112
2-[(2-methoxy-2-oxoethyl)-quinolin-8-ylamino]acetic acid (PubChem CID 59772112) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[(2-methoxy-2-oxoethyl)-quinolin-8-ylamino]acetic acid.
| Compound Name | 2-[(2-methoxy-2-oxoethyl)-quinolin-8-ylamino]acetic acid |
|---|---|
| PubChem CID | 59772112 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[(2-methoxy-2-oxoethyl)-quinolin-8-ylamino]acetic acid |
| SMILES | COC(=O)CN(CC(=O)O)c1cccc2cccnc12 |
| InChI | InChI=1S/C14H14N2O4/c1-20-13(19)9-16(8-12(17)18)11-6-2-4-10-5-3-7-15-14(10)11/h2-7H,8-9H2,1H3,(H,17,18) |
| InChIKey | SPQYDVDMNPTPLA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |