C13H17N3 — CID 114900586
N'-ethyl-N'-quinolin-8-ylethane-1,2-diamine (PubChem CID 114900586) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N'-ethyl-N'-quinolin-8-ylethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-quinolin-8-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 114900586 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N'-ethyl-N'-quinolin-8-ylethane-1,2-diamine |
| SMILES | CCN(CCN)c1cccc2cccnc12 |
| InChI | InChI=1S/C13H17N3/c1-2-16(10-8-14)12-7-3-5-11-6-4-9-15-13(11)12/h3-7,9H,2,8,10,14H2,1H3 |
| InChIKey | HDNQEPQMEKQZMA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |