C18H17NO5 — CID 59772153
2-(4-benzoyl-N-(2-methoxy-2-oxoethyl)anilino)acetic acid (PubChem CID 59772153) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(4-benzoyl-N-(2-methoxy-2-oxoethyl)anilino)acetic acid.
| Compound Name | 2-(4-benzoyl-N-(2-methoxy-2-oxoethyl)anilino)acetic acid |
|---|---|
| PubChem CID | 59772153 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-(4-benzoyl-N-(2-methoxy-2-oxoethyl)anilino)acetic acid |
| SMILES | COC(=O)CN(CC(=O)O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H17NO5/c1-24-17(22)12-19(11-16(20)21)15-9-7-14(8-10-15)18(23)13-5-3-2-4-6-13/h2-10H,11-12H2,1H3,(H,20,21) |
| InChIKey | ZQYSOMQGKKGNDZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |