C14H19N5S — CID 59777251
4-(4-methylpiperazin-1-yl)-6-(thiophen-3-ylmethyl)pyrimidin-2-amine (PubChem CID 59777251) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-6-(thiophen-3-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-6-(thiophen-3-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59777251 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-6-(thiophen-3-ylmethyl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2cc(Cc3ccsc3)nc(N)n2)CC1 |
| InChI | InChI=1S/C14H19N5S/c1-18-3-5-19(6-4-18)13-9-12(16-14(15)17-13)8-11-2-7-20-10-11/h2,7,9-10H,3-6,8H2,1H3,(H2,15,16,17) |
| InChIKey | IGLUXPZYJKPYQP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |