C19H29N5 — CID 59777293
4-(2-adamantyl)-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrimidin-2-amine (PubChem CID 59777293) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 4-(2-adamantyl)-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-(2-adamantyl)-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 59777293 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 4-(2-adamantyl)-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]pyrimidin-2-amine |
| SMILES | CN[C@@H]1CCN(c2cc(C3C4CC5CC(C4)CC3C5)nc(N)n2)C1 |
| InChI | InChI=1S/C19H29N5/c1-21-15-2-3-24(10-15)17-9-16(22-19(20)23-17)18-13-5-11-4-12(7-13)8-14(18)6-11/h9,11-15,18,21H,2-8,10H2,1H3,(H2,20,22,23)/t11?,12?,13?,14?,15-,18?/m1/s1 |
| InChIKey | TUGMMOKSWVHORP-PETOAZBISA-N |
| XLogP | 2.40 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |